C19H15F5N2O3 — CID 55756648
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-[4-(trifluoromethoxy)phenyl]acetate (PubChem CID 55756648) has the molecular formula C19H15F5N2O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-[4-(trifluoromethoxy)phenyl]acetate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-[4-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 55756648 |
| Molecular Formula | C19H15F5N2O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-[4-(trifluoromethoxy)phenyl]acetate |
| SMILES | CC(OC(=O)Cc1ccc(OC(F)(F)F)cc1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C19H15F5N2O3/c1-11(17-25-14-4-2-3-5-15(14)26(17)18(20)21)28-16(27)10-12-6-8-13(9-7-12)29-19(22,23)24/h2-9,11,18H,10H2,1H3 |
| InChIKey | WEGZWXSVGJWFNB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |