C17H15F2N3O2 — CID 134001745
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 6-methylpyridine-2-carboxylate (PubChem CID 134001745) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 6-methylpyridine-2-carboxylate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 6-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 134001745 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 6-methylpyridine-2-carboxylate |
| SMILES | Cc1cccc(C(=O)OC(C)c2nc3ccccc3n2C(F)F)n1 |
| InChI | InChI=1S/C17H15F2N3O2/c1-10-6-5-8-13(20-10)16(23)24-11(2)15-21-12-7-3-4-9-14(12)22(15)17(18)19/h3-9,11,17H,1-2H3 |
| InChIKey | TVIZNODNIRADFO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |