C17H12F4N2O2 — CID 18155838
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 3,5-difluorobenzoate (PubChem CID 18155838) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 3,5-difluorobenzoate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 18155838 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 3,5-difluorobenzoate |
| SMILES | CC(OC(=O)c1cc(F)cc(F)c1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C17H12F4N2O2/c1-9(25-16(24)10-6-11(18)8-12(19)7-10)15-22-13-4-2-3-5-14(13)23(15)17(20)21/h2-9,17H,1H3 |
| InChIKey | XCMZROIDZQUALU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |