C17H14F2N2O2 — CID 18155834
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl benzoate (PubChem CID 18155834) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl benzoate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl benzoate |
|---|---|
| PubChem CID | 18155834 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl benzoate |
| SMILES | CC(OC(=O)c1ccccc1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C17H14F2N2O2/c1-11(23-16(22)12-7-3-2-4-8-12)15-20-13-9-5-6-10-14(13)21(15)17(18)19/h2-11,17H,1H3 |
| InChIKey | AQQUSEYVLMTWMN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |