C19H18F2N2O3S — CID 55380808
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 55380808) has the molecular formula C19H18F2N2O3S and a molecular weight of 392.43 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-(4-methoxyphenyl)sulfanylacetate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-(4-methoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 55380808 |
| Molecular Formula | C19H18F2N2O3S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 2-(4-methoxyphenyl)sulfanylacetate |
| SMILES | COc1ccc(SCC(=O)OC(C)c2nc3ccccc3n2C(F)F)cc1 |
| InChI | InChI=1S/C19H18F2N2O3S/c1-12(18-22-15-5-3-4-6-16(15)23(18)19(20)21)26-17(24)11-27-14-9-7-13(25-2)8-10-14/h3-10,12,19H,11H2,1-2H3 |
| InChIKey | QYJKUTRAIHJTHF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |