C17H13ClF2N2O3 — CID 16624269
[1-(difluoromethyl)benzimidazol-2-yl]methyl 5-chloro-2-methoxybenzoate (PubChem CID 16624269) has the molecular formula C17H13ClF2N2O3 and a molecular weight of 366.75 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 5-chloro-2-methoxybenzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 16624269 |
| Molecular Formula | C17H13ClF2N2O3 |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)OCc1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C17H13ClF2N2O3/c1-24-14-7-6-10(18)8-11(14)16(23)25-9-15-21-12-4-2-3-5-13(12)22(15)17(19)20/h2-8,17H,9H2,1H3 |
| InChIKey | IWURPPPWMSPOPZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |