C18H15F2N3O4S — CID 18207926
[1-(difluoromethyl)benzimidazol-2-yl]methyl (E)-3-(4-sulfamoylphenyl)prop-2-enoate (PubChem CID 18207926) has the molecular formula C18H15F2N3O4S and a molecular weight of 407.40 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl (E)-3-(4-sulfamoylphenyl)prop-2-enoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl (E)-3-(4-sulfamoylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18207926 |
| Molecular Formula | C18H15F2N3O4S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl (E)-3-(4-sulfamoylphenyl)prop-2-enoate |
| SMILES | NS(=O)(=O)c1ccc(/C=C/C(=O)OCc2nc3ccccc3n2C(F)F)cc1 |
| InChI | InChI=1S/C18H15F2N3O4S/c19-18(20)23-15-4-2-1-3-14(15)22-16(23)11-27-17(24)10-7-12-5-8-13(9-6-12)28(21,25)26/h1-10,18H,11H2,(H2,21,25,26)/b10-7+ |
| InChIKey | CKNYAFUSXGNWIK-JXMROGBWSA-N |
| XLogP | 2.84 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|