C18H17F2N3O5S — CID 18125541
[1-(difluoromethyl)imidazol-2-yl]methyl 5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoate (PubChem CID 18125541) has the molecular formula C18H17F2N3O5S and a molecular weight of 425.41 g/mol. Its IUPAC name is [1-(difluoromethyl)imidazol-2-yl]methyl 5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [1-(difluoromethyl)imidazol-2-yl]methyl 5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 18125541 |
| Molecular Formula | C18H17F2N3O5S |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | [1-(difluoromethyl)imidazol-2-yl]methyl 5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)OCc1nccn1C(F)F |
| InChI | InChI=1S/C18H17F2N3O5S/c1-12-4-5-14(29(25,26)22-10-13-3-2-8-27-13)9-15(12)17(24)28-11-16-21-6-7-23(16)18(19)20/h2-9,18,22H,10-11H2,1H3 |
| InChIKey | WWAPIBOIINTIRT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |