C24H31N3O4 — CID 35714370
4-(1,3-dioxoisoindol-2-yl)butyl 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate (PubChem CID 35714370) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 35714370 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)OCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H31N3O4/c1-16(2)15-27-18(4)19(17(3)25-27)11-12-22(28)31-14-8-7-13-26-23(29)20-9-5-6-10-21(20)24(26)30/h5-6,9-10,16H,7-8,11-15H2,1-4H3 |
| InChIKey | ZWTNGVILTWWICI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|