C25H29N3O3 — CID 36670453
(4-benzamidophenyl) 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate (PubChem CID 36670453) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (4-benzamidophenyl) 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate.
| Compound Name | (4-benzamidophenyl) 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 36670453 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (4-benzamidophenyl) 3-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]propanoate |
| SMILES | Cc1nn(CC(C)C)c(C)c1CCC(=O)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-17(2)16-28-19(4)23(18(3)27-28)14-15-24(29)31-22-12-10-21(11-13-22)26-25(30)20-8-6-5-7-9-20/h5-13,17H,14-16H2,1-4H3,(H,26,30) |
| InChIKey | UCTIPMQGKVHTRD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|