C24H21Cl2FN4O3 — CID 19396588
N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19396588) has the molecular formula C24H21Cl2FN4O3 and a molecular weight of 503.36 g/mol. Its IUPAC name is N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19396588 |
| Molecular Formula | C24H21Cl2FN4O3 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)Nc1nn(Cc2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C24H21Cl2FN4O3/c25-18-9-6-10-20(27)17(18)13-30-14-19(26)22(29-30)28-21(32)11-2-1-5-12-31-23(33)15-7-3-4-8-16(15)24(31)34/h3-4,6-10,14H,1-2,5,11-13H2,(H,28,29,32) |
| InChIKey | DJGWYXHOXKJIJS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|