C15H18BrClN4O — CID 19405684
1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-butylurea (PubChem CID 19405684) has the molecular formula C15H18BrClN4O and a molecular weight of 385.69 g/mol. Its IUPAC name is 1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-butylurea.
| Compound Name | 1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-butylurea |
|---|---|
| PubChem CID | 19405684 |
| Molecular Formula | C15H18BrClN4O |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-butylurea |
| SMILES | CCCCNC(=O)Nc1nn(Cc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C15H18BrClN4O/c1-2-3-8-18-15(22)19-14-13(16)10-21(20-14)9-11-4-6-12(17)7-5-11/h4-7,10H,2-3,8-9H2,1H3,(H2,18,19,20,22) |
| InChIKey | HGJGFVNGGNEMCX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|