C14H16BrClN4O — CID 19334044
1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(4-chlorophenyl)urea (PubChem CID 19334044) has the molecular formula C14H16BrClN4O and a molecular weight of 371.67 g/mol. Its IUPAC name is 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 19334044 |
| Molecular Formula | C14H16BrClN4O |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(4-chlorophenyl)urea |
| SMILES | Cc1nn(CCCNC(=O)Nc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C14H16BrClN4O/c1-10-13(15)9-20(19-10)8-2-7-17-14(21)18-12-5-3-11(16)4-6-12/h3-6,9H,2,7-8H2,1H3,(H2,17,18,21) |
| InChIKey | JCOUYESDJRMPJG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|