C21H19BrClN3O2 — CID 19329951
N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-(4-chlorobenzoyl)benzamide (PubChem CID 19329951) has the molecular formula C21H19BrClN3O2 and a molecular weight of 460.76 g/mol. Its IUPAC name is N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-(4-chlorobenzoyl)benzamide.
| Compound Name | N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-(4-chlorobenzoyl)benzamide |
|---|---|
| PubChem CID | 19329951 |
| Molecular Formula | C21H19BrClN3O2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-(4-chlorobenzoyl)benzamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C21H19BrClN3O2/c1-14-19(22)13-26(25-14)12-4-11-24-21(28)18-6-3-2-5-17(18)20(27)15-7-9-16(23)10-8-15/h2-3,5-10,13H,4,11-12H2,1H3,(H,24,28) |
| InChIKey | ANOPOPLDKCBZAL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|