C14H15BrIN3O — CID 19328234
N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-iodobenzamide (PubChem CID 19328234) has the molecular formula C14H15BrIN3O and a molecular weight of 448.10 g/mol. Its IUPAC name is N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-iodobenzamide.
| Compound Name | N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 19328234 |
| Molecular Formula | C14H15BrIN3O |
| Molecular Weight | 448.10 g/mol |
| Exact Mass | 446.94 |
| IUPAC Name | N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-2-iodobenzamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccccc2I)cc1Br |
| InChI | InChI=1S/C14H15BrIN3O/c1-10-12(15)9-19(18-10)8-4-7-17-14(20)11-5-2-3-6-13(11)16/h2-3,5-6,9H,4,7-8H2,1H3,(H,17,20) |
| InChIKey | CABCGXGOGGJLQR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.10 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|