C14H14BrN5O5 — CID 19329823
N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dinitrobenzamide (PubChem CID 19329823) has the molecular formula C14H14BrN5O5 and a molecular weight of 412.20 g/mol. Its IUPAC name is N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 19329823 |
| Molecular Formula | C14H14BrN5O5 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | N-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3,5-dinitrobenzamide |
| SMILES | Cc1nn(CCCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1Br |
| InChI | InChI=1S/C14H14BrN5O5/c1-9-13(15)8-18(17-9)4-2-3-16-14(21)10-5-11(19(22)23)7-12(6-10)20(24)25/h5-8H,2-4H2,1H3,(H,16,21) |
| InChIKey | NFEYVRBAGZPYNE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|