C19H21N5S — CID 17298913
1-(3,4-dimethylphenyl)-3-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]thiourea (PubChem CID 17298913) has the molecular formula C19H21N5S and a molecular weight of 351.48 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]thiourea |
|---|---|
| PubChem CID | 17298913 |
| Molecular Formula | C19H21N5S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]thiourea |
| SMILES | Cc1ccc(Cn2cnc(NC(=S)Nc3ccc(C)c(C)c3)n2)cc1 |
| InChI | InChI=1S/C19H21N5S/c1-13-4-7-16(8-5-13)11-24-12-20-18(23-24)22-19(25)21-17-9-6-14(2)15(3)10-17/h4-10,12H,11H2,1-3H3,(H2,21,22,23,25) |
| InChIKey | PKPFYTKMDYXKFV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|