C15H17N3O4 — CID 12024872
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(2-hydroxy-5-methylphenyl)propan-1-one (PubChem CID 12024872) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(2-hydroxy-5-methylphenyl)propan-1-one.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(2-hydroxy-5-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 12024872 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(2-hydroxy-5-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(O)c(C(=O)CCn2nc(C)c([N+](=O)[O-])c2C)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-9-4-5-13(19)12(8-9)14(20)6-7-17-11(3)15(18(21)22)10(2)16-17/h4-5,8,19H,6-7H2,1-3H3 |
| InChIKey | XINYOTBAQCKYHF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|