C19H20N4O3 — CID 19400381
1-ethyl-N-(furan-2-ylmethyl)-4-[(2-methylbenzoyl)amino]pyrazole-3-carboxamide (PubChem CID 19400381) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-ethyl-N-(furan-2-ylmethyl)-4-[(2-methylbenzoyl)amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[(2-methylbenzoyl)amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400381 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[(2-methylbenzoyl)amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccccc2C)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C19H20N4O3/c1-3-23-12-16(21-18(24)15-9-5-4-7-13(15)2)17(22-23)19(25)20-11-14-8-6-10-26-14/h4-10,12H,3,11H2,1-2H3,(H,20,25)(H,21,24) |
| InChIKey | BSTBHNJDFQRMCM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |