C19H19ClN4O4 — CID 19400331
4-[(5-chloro-2-methoxybenzoyl)amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19400331) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is 4-[(5-chloro-2-methoxybenzoyl)amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[(5-chloro-2-methoxybenzoyl)amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400331 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-[(5-chloro-2-methoxybenzoyl)amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cc(Cl)ccc2OC)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-3-24-11-15(17(23-24)19(26)21-10-13-5-4-8-28-13)22-18(25)14-9-12(20)6-7-16(14)27-2/h4-9,11H,3,10H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | RNISZUMPAGYVML-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |