C19H8ClF7N2O5 — CID 19461879
5-[(2-chloro-4-nitrophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 19461879) has the molecular formula C19H8ClF7N2O5 and a molecular weight of 512.72 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461879 |
| Molecular Formula | C19H8ClF7N2O5 |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccc(COc2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C19H8ClF7N2O5/c20-9-5-7(29(31)32)1-3-10(9)33-6-8-2-4-11(34-8)18(30)28-17-15(23)13(21)12(19(25,26)27)14(22)16(17)24/h1-5H,6H2,(H,28,30) |
| InChIKey | ITQYRHPBJGCQRB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|