C24H26N4O7S — CID 4062963
dipropan-2-yl 3-methyl-5-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 4062963) has the molecular formula C24H26N4O7S and a molecular weight of 514.56 g/mol. Its IUPAC name is dipropan-2-yl 3-methyl-5-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | dipropan-2-yl 3-methyl-5-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4062963 |
| Molecular Formula | C24H26N4O7S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | dipropan-2-yl 3-methyl-5-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)cc2)c1C(=O)OC(C)C |
| InChI | InChI=1S/C24H26N4O7S/c1-13(2)34-23(30)19-15(5)20(24(31)35-14(3)4)36-22(19)26-21(29)17-8-6-16(7-9-17)11-27-12-18(10-25-27)28(32)33/h6-10,12-14H,11H2,1-5H3,(H,26,29) |
| InChIKey | SYLOWAAFUUYYLW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|