C17H20N6O4 — CID 19459210
N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 19459210) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459210 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | CCn1cc(C(C)NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)c(C)n1 |
| InChI | InChI=1S/C17H20N6O4/c1-4-21-10-15(12(3)20-21)11(2)19-17(24)16-6-5-14(27-16)9-22-8-13(7-18-22)23(25)26/h5-8,10-11H,4,9H2,1-3H3,(H,19,24) |
| InChIKey | LDGMMVDPZZLANP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|