C30H26N4O7S2 — CID 18910618
ethyl 4-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate (PubChem CID 18910618) has the molecular formula C30H26N4O7S2 and a molecular weight of 618.69 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910618 |
| Molecular Formula | C30H26N4O7S2 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | ethyl 4-methyl-2-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)sc(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C30H26N4O7S2/c1-3-41-30(38)25-18(2)26(28(37)31-20-10-5-4-6-11-20)43-29(25)33-24(35)17-42-23-14-8-12-21(16-23)32-27(36)19-9-7-13-22(15-19)34(39)40/h4-16H,3,17H2,1-2H3,(H,31,37)(H,32,36)(H,33,35) |
| InChIKey | IDTFFOLXDIPWLK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|