C37H28N6O6S2 — CID 19052999
5-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide (PubChem CID 19052999) has the molecular formula C37H28N6O6S2 and a molecular weight of 716.80 g/mol. Its IUPAC name is 5-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide.
| Compound Name | 5-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 19052999 |
| Molecular Formula | C37H28N6O6S2 |
| Molecular Weight | 716.80 g/mol |
| Exact Mass | 716.15 |
| IUPAC Name | 5-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)sc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)c1C#N |
| InChI | InChI=1S/C37H28N6O6S2/c1-23-30(21-38)37(51-33(23)36(47)39-26-11-6-3-7-12-26)42-32(44)22-50-29-14-8-13-27(20-29)40-35(46)31(41-34(45)25-9-4-2-5-10-25)19-24-15-17-28(18-16-24)43(48)49/h2-20H,22H2,1H3,(H,39,47)(H,40,46)(H,41,45)(H,42,44)/b31-19+ |
| InChIKey | PHPOBUIZJQZOBY-ZCTHSVRISA-N |
| XLogP | 7.23 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.80 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|