C29H32N2O4S2 — CID 18911255
ethyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18911255) has the molecular formula C29H32N2O4S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18911255 |
| Molecular Formula | C29H32N2O4S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | ethyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)c3ccccc3C)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C29H32N2O4S2/c1-3-35-29(34)26-23-15-6-4-5-7-16-24(23)37-28(26)31-25(32)18-36-21-13-10-12-20(17-21)30-27(33)22-14-9-8-11-19(22)2/h8-14,17H,3-7,15-16,18H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | XNEDNQUQRHSKKI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |