C40H33Cl2N3O5S2 — CID 19050806
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19050806) has the molecular formula C40H33Cl2N3O5S2 and a molecular weight of 770.76 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050806 |
| Molecular Formula | C40H33Cl2N3O5S2 |
| Molecular Weight | 770.76 g/mol |
| Exact Mass | 769.12 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3ccc(Cl)cc3Cl)NC(=O)c3ccccc3)c2)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C40H33Cl2N3O5S2/c1-50-40(49)34-30-17-8-9-18-33(30)52-39(34)45-38(48)35(24-11-4-2-5-12-24)51-29-16-10-15-28(23-29)43-37(47)32(21-26-19-20-27(41)22-31(26)42)44-36(46)25-13-6-3-7-14-25/h2-7,10-16,19-23,35H,8-9,17-18H2,1H3,(H,43,47)(H,44,46)(H,45,48)/b32-21+ |
| InChIKey | NOVYHJPOZUDZNT-RUMWWMSVSA-N |
| XLogP | 9.60 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.76 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|