C37H36FN3O5S2 — CID 19052281
methyl 2-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19052281) has the molecular formula C37H36FN3O5S2 and a molecular weight of 685.84 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052281 |
| Molecular Formula | C37H36FN3O5S2 |
| Molecular Weight | 685.84 g/mol |
| Exact Mass | 685.21 |
| IUPAC Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3ccccc3F)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C37H36FN3O5S2/c1-23(33(42)41-36-32(37(45)46-2)28-18-8-3-4-9-20-31(28)48-36)47-27-17-12-16-26(22-27)39-35(44)30(21-25-15-10-11-19-29(25)38)40-34(43)24-13-6-5-7-14-24/h5-7,10-17,19,21-23H,3-4,8-9,18,20H2,1-2H3,(H,39,44)(H,40,43)(H,41,42)/b30-21- |
| InChIKey | LKHLLGBDWTUWHQ-OFWBYEQRSA-N |
| XLogP | 7.86 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.84 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|