C43H49N3O8S2 — CID 19054201
methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19054201) has the molecular formula C43H49N3O8S2 and a molecular weight of 800.01 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054201 |
| Molecular Formula | C43H49N3O8S2 |
| Molecular Weight | 800.01 g/mol |
| Exact Mass | 799.30 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)c(OC)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C43H49N3O8S2/c1-9-34(40(49)46-41-36(42(50)54-8)30-19-18-27(43(2,3)4)23-35(30)56-41)55-29-17-13-16-28(24-29)44-39(48)31(45-38(47)26-14-11-10-12-15-26)20-25-21-32(51-5)37(53-7)33(22-25)52-6/h10-17,20-22,24,27,34H,9,18-19,23H2,1-8H3,(H,44,48)(H,45,47)(H,46,49)/b31-20+ |
| InChIKey | IRLLQRFZUVZTET-AJBULDERSA-N |
| XLogP | 8.63 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.01 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|