C42H47N3O7S2 — CID 19051232
ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19051232) has the molecular formula C42H47N3O7S2 and a molecular weight of 769.99 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051232 |
| Molecular Formula | C42H47N3O7S2 |
| Molecular Weight | 769.99 g/mol |
| Exact Mass | 769.29 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3cc(OC)ccc3OC)NC(=O)c3ccccc3)c2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C42H47N3O7S2/c1-8-52-41(49)36-32-19-17-28(42(3,4)5)23-35(32)54-40(36)45-37(46)25(2)53-31-16-12-15-29(24-31)43-39(48)33(44-38(47)26-13-10-9-11-14-26)22-27-21-30(50-6)18-20-34(27)51-7/h9-16,18,20-22,24-25,28H,8,17,19,23H2,1-7H3,(H,43,48)(H,44,47)(H,45,46)/b33-22+ |
| InChIKey | DHTDHVJHYLIRLC-STKMKYKTSA-N |
| XLogP | 8.62 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.99 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|