C25H26N2O2S — CID 18901747
N-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide (PubChem CID 18901747) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide.
| Compound Name | N-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 18901747 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[3-[2-(3-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(SC(C(=O)Nc2cccc(C)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O2S/c1-3-9-23(28)26-21-14-8-15-22(17-21)30-24(19-11-5-4-6-12-19)25(29)27-20-13-7-10-18(2)16-20/h4-8,10-17,24H,3,9H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | GDZSZMHOVFCCLD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |