C31H30N2O3S — CID 23101069
2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenyl-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 23101069) has the molecular formula C31H30N2O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenyl-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 23101069 |
| Molecular Formula | C31H30N2O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2-[4-[(2-phenoxyacetyl)amino]phenyl]sulfanyl-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)C(Sc2ccc(NC(=O)COc3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N2O3S/c1-22(2)23-13-15-26(16-14-23)33-31(35)30(24-9-5-3-6-10-24)37-28-19-17-25(18-20-28)32-29(34)21-36-27-11-7-4-8-12-27/h3-20,22,30H,21H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | HICCTRZYCMUVEO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |