C23H23ClN2O2S2 — CID 19677496
1-[2-(4-chlorophenyl)sulfanylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea (PubChem CID 19677496) has the molecular formula C23H23ClN2O2S2 and a molecular weight of 459.04 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19677496 |
| Molecular Formula | C23H23ClN2O2S2 |
| Molecular Weight | 459.04 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylphenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2ccccc2Sc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C23H23ClN2O2S2/c1-27-20-12-7-16(15-21(20)28-2)13-14-25-23(29)26-19-5-3-4-6-22(19)30-18-10-8-17(24)9-11-18/h3-12,15H,13-14H2,1-2H3,(H2,25,26,29) |
| InChIKey | PUNSIZWGBVHJAG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.04 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|