C23H24N2O2S2 — CID 19677683
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-phenylsulfanylphenyl)thiourea (PubChem CID 19677683) has the molecular formula C23H24N2O2S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-phenylsulfanylphenyl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-phenylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 19677683 |
| Molecular Formula | C23H24N2O2S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-phenylsulfanylphenyl)thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2ccccc2Sc2ccccc2)cc1OC |
| InChI | InChI=1S/C23H24N2O2S2/c1-26-20-13-12-17(16-21(20)27-2)14-15-24-23(28)25-19-10-6-7-11-22(19)29-18-8-4-3-5-9-18/h3-13,16H,14-15H2,1-2H3,(H2,24,25,28) |
| InChIKey | DNKWRBZJUGFJQX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|