C20H20F3N5OS — CID 134429288
N-(6-methoxy-1H-benzimidazol-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 134429288) has the molecular formula C20H20F3N5OS and a molecular weight of 435.48 g/mol. Its IUPAC name is N-(6-methoxy-1H-benzimidazol-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(6-methoxy-1H-benzimidazol-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 134429288 |
| Molecular Formula | C20H20F3N5OS |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-(6-methoxy-1H-benzimidazol-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | COc1ccc2nc(NC(=S)N3CCN(c4cccc(C(F)(F)F)c4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C20H20F3N5OS/c1-29-15-5-6-16-17(12-15)25-18(24-16)26-19(30)28-9-7-27(8-10-28)14-4-2-3-13(11-14)20(21,22)23/h2-6,11-12H,7-10H2,1H3,(H2,24,25,26,30) |
| InChIKey | UQFAHACZKFTSIL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|