C20H26F3N3O2 — CID 17490131
N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide (PubChem CID 17490131) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17490131 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C20H26F3N3O2/c21-20(22,23)16-7-4-8-17(13-16)25-9-11-26(12-10-25)18(27)14-24-19(28)15-5-2-1-3-6-15/h4,7-8,13,15H,1-3,5-6,9-12,14H2,(H,24,28) |
| InChIKey | RMENMYNJNXELSJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |