C20H25BrN4O2S — CID 55853534
5-bromo-N-[2-oxo-2-[3-(4-phenylpiperazin-1-yl)propylamino]ethyl]thiophene-2-carboxamide (PubChem CID 55853534) has the molecular formula C20H25BrN4O2S and a molecular weight of 465.42 g/mol. Its IUPAC name is 5-bromo-N-[2-oxo-2-[3-(4-phenylpiperazin-1-yl)propylamino]ethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-oxo-2-[3-(4-phenylpiperazin-1-yl)propylamino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55853534 |
| Molecular Formula | C20H25BrN4O2S |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 5-bromo-N-[2-oxo-2-[3-(4-phenylpiperazin-1-yl)propylamino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)s1)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25BrN4O2S/c21-18-8-7-17(28-18)20(27)23-15-19(26)22-9-4-10-24-11-13-25(14-12-24)16-5-2-1-3-6-16/h1-3,5-8H,4,9-15H2,(H,22,26)(H,23,27) |
| InChIKey | BYBRMIYNRNCPJW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|