C14H20BrN3O3S — CID 55835114
5-bromo-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55835114) has the molecular formula C14H20BrN3O3S and a molecular weight of 390.30 g/mol. Its IUPAC name is 5-bromo-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55835114 |
| Molecular Formula | C14H20BrN3O3S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-bromo-N-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)s1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C14H20BrN3O3S/c15-12-3-2-11(22-12)14(20)17-10-13(19)16-4-1-5-18-6-8-21-9-7-18/h2-3H,1,4-10H2,(H,16,19)(H,17,20) |
| InChIKey | NXSMSKQGGFRBEX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|