C22H30N5OS+ — CID 8614651
1-(3,5-dimethylphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea (PubChem CID 8614651) has the molecular formula C22H30N5OS+ and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 8614651 |
| Molecular Formula | C22H30N5OS+ |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H29N5OS/c1-17-14-18(2)16-19(15-17)23-22(29)25-24-21(28)8-9-26-10-12-27(13-11-26)20-6-4-3-5-7-20/h3-7,14-16H,8-13H2,1-2H3,(H,24,28)(H2,23,25,29)/p+1 |
| InChIKey | ZIHDOLHUQJKKIE-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|