C18H23N4OS+ — CID 9112890
3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]propanamide (PubChem CID 9112890) has the molecular formula C18H23N4OS+ and a molecular weight of 343.48 g/mol. Its IUPAC name is 3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]propanamide.
| Compound Name | 3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 9112890 |
| Molecular Formula | C18H23N4OS+ |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-(4-phenylpiperazin-1-ium-1-yl)-N-[(Z)-thiophen-3-ylmethylideneamino]propanamide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)N/N=C\c1ccsc1 |
| InChI | InChI=1S/C18H22N4OS/c23-18(20-19-14-16-7-13-24-15-16)6-8-21-9-11-22(12-10-21)17-4-2-1-3-5-17/h1-5,7,13-15H,6,8-12H2,(H,20,23)/p+1/b19-14- |
| InChIKey | ZSBKKQYUHQLKAK-RGEXLXHISA-O |
| XLogP | 0.99 |
| TPSA | 49.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|