C20H25FN3O2+ — CID 8592588
N-(2-fluoro-4-methylphenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8592588) has the molecular formula C20H25FN3O2+ and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8592588 |
| Molecular Formula | C20H25FN3O2+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1cccc(N2CC[NH+](CC(=O)Nc3ccc(C)cc3F)CC2)c1 |
| InChI | InChI=1S/C20H24FN3O2/c1-15-6-7-19(18(21)12-15)22-20(25)14-23-8-10-24(11-9-23)16-4-3-5-17(13-16)26-2/h3-7,12-13H,8-11,14H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | YATQFKOSMYINIH-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |