C21H26ClN3O3+2 — CID 7155492
methyl 3-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-chlorobenzoate (PubChem CID 7155492) has the molecular formula C21H26ClN3O3+2 and a molecular weight of 403.91 g/mol. Its IUPAC name is methyl 3-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 7155492 |
| Molecular Formula | C21H26ClN3O3+2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | methyl 3-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CC[NH+](Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-28-21(27)17-7-8-18(22)19(13-17)23-20(26)15-25-11-9-24(10-12-25)14-16-5-3-2-4-6-16/h2-8,13H,9-12,14-15H2,1H3,(H,23,26)/p+2 |
| InChIKey | HYOGEDYQZJXHPP-UHFFFAOYSA-P |
| XLogP | 0.05 |
| TPSA | 64.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |