C23H37N3O+2 — CID 7450772
2-(4-benzylpiperazine-1,4-diium-1-yl)-N-[(1R,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 7450772) has the molecular formula C23H37N3O+2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-[(1R,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-[(1R,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 7450772 |
| Molecular Formula | C23H37N3O+2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-[(1R,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@H](C2)[C@@]1(C)NC(=O)C[NH+]1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H35N3O/c1-22(2)19-9-10-20(15-19)23(22,3)24-21(27)17-26-13-11-25(12-14-26)16-18-7-5-4-6-8-18/h4-8,19-20H,9-17H2,1-3H3,(H,24,27)/p+2/t19-,20+,23+/m0/s1 |
| InChIKey | JXNSNYXXAYEPMB-MIZPHKNDSA-P |
| XLogP | 0.30 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |