C17H29N2O+ — CID 23308818
2-(1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-[(1S,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 23308818) has the molecular formula C17H29N2O+ and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-(1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-[(1S,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-(1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-[(1S,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 23308818 |
| Molecular Formula | C17H29N2O+ |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 2-(1,2,3,6-tetrahydropyridin-1-ium-1-yl)-N-[(1S,2R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@@H](C2)[C@@]1(C)NC(=O)C[NH+]1CC=CCC1 |
| InChI | InChI=1S/C17H28N2O/c1-16(2)13-7-8-14(11-13)17(16,3)18-15(20)12-19-9-5-4-6-10-19/h4-5,13-14H,6-12H2,1-3H3,(H,18,20)/p+1/t13-,14-,17+/m0/s1 |
| InChIKey | OJCPOTLGLDXZDT-GRDNDAEWSA-O |
| XLogP | 1.16 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|