C21H33N2O+ — CID 3624654
benzyl-dimethyl-[2-oxo-2-[(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethyl]azanium (PubChem CID 3624654) has the molecular formula C21H33N2O+ and a molecular weight of 329.51 g/mol. Its IUPAC name is benzyl-dimethyl-[2-oxo-2-[(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethyl]azanium.
| Compound Name | benzyl-dimethyl-[2-oxo-2-[(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 3624654 |
| Molecular Formula | C21H33N2O+ |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | benzyl-dimethyl-[2-oxo-2-[(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethyl]azanium |
| SMILES | CC1(C)C2CCC(C2)C1(C)NC(=O)C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H32N2O/c1-20(2)17-11-12-18(13-17)21(20,3)22-19(24)15-23(4,5)14-16-9-7-6-8-10-16/h6-10,17-18H,11-15H2,1-5H3/p+1 |
| InChIKey | ROMHPUVAZGVPHJ-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|