C21H33ClN2O — CID 52997660
benzyl-dimethyl-[2-oxo-2-[[(1R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium chloride (PubChem CID 52997660) has the molecular formula C21H33ClN2O and a molecular weight of 364.96 g/mol. Its IUPAC name is benzyl-dimethyl-[2-oxo-2-[[(1R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium chloride.
| Compound Name | benzyl-dimethyl-[2-oxo-2-[[(1R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium chloride |
|---|---|
| PubChem CID | 52997660 |
| Molecular Formula | C21H33ClN2O |
| Molecular Weight | 364.96 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | benzyl-dimethyl-[2-oxo-2-[[(1R,4S)-2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]ethyl]azanium chloride |
| SMILES | CC1(C)[C@H]2CC[C@H](C2)C1(C)NC(=O)C[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H32N2O.ClH/c1-20(2)17-11-12-18(13-17)21(20,3)22-19(24)15-23(4,5)14-16-9-7-6-8-10-16;/h6-10,17-18H,11-15H2,1-5H3;1H/t17-,18+,21?;/m0./s1 |
| InChIKey | SJICFSMVCFZMDT-KIXFMWMNSA-N |
| XLogP | 0.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.96 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|