C13H15Cl2N3O2 — CID 115618777
5,6-dichloro-N-(2-oxo-2-piperidin-1-ylethyl)pyridine-3-carboxamide (PubChem CID 115618777) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-oxo-2-piperidin-1-ylethyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(2-oxo-2-piperidin-1-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115618777 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 5,6-dichloro-N-(2-oxo-2-piperidin-1-ylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC(=O)N1CCCCC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c14-10-6-9(7-16-12(10)15)13(20)17-8-11(19)18-4-2-1-3-5-18/h6-7H,1-5,8H2,(H,17,20) |
| InChIKey | OUDKSGDIJUKKJL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|