C19H24Cl2N2O7 — CID 166599833
2,5-dichloro-N-[2-[(4S,5S)-4,5-dihydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]benzamide;formic acid (PubChem CID 166599833) has the molecular formula C19H24Cl2N2O7 and a molecular weight of 463.31 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[(4S,5S)-4,5-dihydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]benzamide;formic acid.
| Compound Name | 2,5-dichloro-N-[2-[(4S,5S)-4,5-dihydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]benzamide;formic acid |
|---|---|
| PubChem CID | 166599833 |
| Molecular Formula | C19H24Cl2N2O7 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2,5-dichloro-N-[2-[(4S,5S)-4,5-dihydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-oxoethyl]benzamide;formic acid |
| SMILES | O=C(NCC(=O)N1CCC2(CC1)OCC[C@H](O)[C@@H]2O)c1cc(Cl)ccc1Cl.O=CO |
| InChI | InChI=1S/C18H22Cl2N2O5.CH2O2/c19-11-1-2-13(20)12(9-11)17(26)21-10-15(24)22-6-4-18(5-7-22)16(25)14(23)3-8-27-18;2-1-3/h1-2,9,14,16,23,25H,3-8,10H2,(H,21,26);1H,(H,2,3)/t14-,16-;/m0./s1 |
| InChIKey | NFMDSRDGQOXTHF-DMLYUBSXSA-N |
| XLogP | 0.93 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|