C18H25BCl2N2O3 — CID 142418320
2,5-dichloro-N-[2-[[(1R)-1-(3,4-dimethyloxaboretan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 142418320) has the molecular formula C18H25BCl2N2O3 and a molecular weight of 399.13 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-1-(3,4-dimethyloxaboretan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-1-(3,4-dimethyloxaboretan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 142418320 |
| Molecular Formula | C18H25BCl2N2O3 |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-1-(3,4-dimethyloxaboretan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(C)C1C |
| InChI | InChI=1S/C18H25BCl2N2O3/c1-10(2)7-16(19-11(3)12(4)26-19)23-17(24)9-22-18(25)14-8-13(20)5-6-15(14)21/h5-6,8,10-12,16H,7,9H2,1-4H3,(H,22,25)(H,23,24)/t11?,12?,16-/m0/s1 |
| InChIKey | DMRSXPVQKMUBKA-PPUFBPAQSA-N |
| XLogP | 3.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|