C21H28BCl2N3O6 — CID 156687954
2,5-dichloro-N-[2-[[(1R)-1-[(4R)-4,6-dimethyl-3,8-dioxo-2,9-dioxa-6-azonia-1-boranuidabicyclo[4.3.0]nonan-1-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 156687954) has the molecular formula C21H28BCl2N3O6 and a molecular weight of 500.19 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-1-[(4R)-4,6-dimethyl-3,8-dioxo-2,9-dioxa-6-azonia-1-boranuidabicyclo[4.3.0]nonan-1-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-1-[(4R)-4,6-dimethyl-3,8-dioxo-2,9-dioxa-6-azonia-1-boranuidabicyclo[4.3.0]nonan-1-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 156687954 |
| Molecular Formula | C21H28BCl2N3O6 |
| Molecular Weight | 500.19 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-1-[(4R)-4,6-dimethyl-3,8-dioxo-2,9-dioxa-6-azonia-1-boranuidabicyclo[4.3.0]nonan-1-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)[B-]12OC(=O)C[N+]1(C)C[C@@H](C)C(=O)O2 |
| InChI | InChI=1S/C21H28BCl2N3O6/c1-12(2)7-17(22-27(4,11-19(29)32-22)10-13(3)21(31)33-22)26-18(28)9-25-20(30)15-8-14(23)5-6-16(15)24/h5-6,8,12-13,17H,7,9-11H2,1-4H3,(H,25,30)(H,26,28)/t13-,17+,22?,27?/m1/s1 |
| InChIKey | NOOKCPVVRQBBKQ-PUJLBUQYSA-N |
| XLogP | 1.93 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|